C19H26F3N3O2 — CID 95727046
methyl 2-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]acetate (PubChem CID 95727046) has the molecular formula C19H26F3N3O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is methyl 2-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]acetate.
| Compound Name | methyl 2-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 95727046 |
| Molecular Formula | C19H26F3N3O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | methyl 2-[(3S)-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1CCC[C@H](N2CCN(c3cccc(C(F)(F)F)c3)CC2)C1 |
| InChI | InChI=1S/C19H26F3N3O2/c1-27-18(26)14-23-7-3-6-17(13-23)25-10-8-24(9-11-25)16-5-2-4-15(12-16)19(20,21)22/h2,4-5,12,17H,3,6-11,13-14H2,1H3/t17-/m0/s1 |
| InChIKey | KCYZJYRUEDKHGC-KRWDZBQOSA-N |
| XLogP | 2.46 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |