C21H29F3N4O — CID 57442446
1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 57442446) has the molecular formula C21H29F3N4O and a molecular weight of 410.48 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57442446 |
| Molecular Formula | C21H29F3N4O |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2cccc(C(F)(F)F)c2)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C21H29F3N4O/c22-21(23,24)17-3-1-6-19(15-17)27-9-7-25(8-10-27)16-20(29)28-13-11-26(12-14-28)18-4-2-5-18/h1,3,6,15,18H,2,4-5,7-14,16H2 |
| InChIKey | ICMPERYQJMUMAA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |