C22H29F3N4O2 — CID 57442744
1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone (PubChem CID 57442744) has the molecular formula C22H29F3N4O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57442744 |
| Molecular Formula | C22H29F3N4O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(C(=O)c2cccc(C(F)(F)F)c2)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C22H29F3N4O2/c23-22(24,25)18-4-1-3-17(15-18)21(31)29-9-7-26(8-10-29)16-20(30)28-13-11-27(12-14-28)19-5-2-6-19/h1,3-4,15,19H,2,5-14,16H2 |
| InChIKey | XVTBBSRTFFGBDL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |