C21H28BrFN4O2 — CID 57442549
2-[4-(3-bromo-4-fluorobenzoyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone (PubChem CID 57442549) has the molecular formula C21H28BrFN4O2 and a molecular weight of 467.38 g/mol. Its IUPAC name is 2-[4-(3-bromo-4-fluorobenzoyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-(3-bromo-4-fluorobenzoyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 57442549 |
| Molecular Formula | C21H28BrFN4O2 |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[4-(3-bromo-4-fluorobenzoyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(C(=O)c2ccc(F)c(Br)c2)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C21H28BrFN4O2/c22-18-14-16(4-5-19(18)23)21(29)27-8-6-24(7-9-27)15-20(28)26-12-10-25(11-13-26)17-2-1-3-17/h4-5,14,17H,1-3,6-13,15H2 |
| InChIKey | MRVLJFLPIGNAON-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |