C19H27BrN4O2S — CID 57442614
2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone (PubChem CID 57442614) has the molecular formula C19H27BrN4O2S and a molecular weight of 455.42 g/mol. Its IUPAC name is 2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 57442614 |
| Molecular Formula | C19H27BrN4O2S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-[4-(3-bromothiophene-2-carbonyl)piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(C(=O)c2sccc2Br)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C19H27BrN4O2S/c20-16-4-13-27-18(16)19(26)24-7-5-21(6-8-24)14-17(25)23-11-9-22(10-12-23)15-2-1-3-15/h4,13,15H,1-3,5-12,14H2 |
| InChIKey | SCBXDOSOZXBKIO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |