C21H32N4O2S — CID 57442730
1-(4-cyclobutylpiperazin-1-yl)-2-[4-(5-ethylthiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 57442730) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(5-ethylthiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(5-ethylthiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57442730 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(5-ethylthiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CCc1ccc(C(=O)N2CCN(CC(=O)N3CCN(C4CCC4)CC3)CC2)s1 |
| InChI | InChI=1S/C21H32N4O2S/c1-2-18-6-7-19(28-18)21(27)25-10-8-22(9-11-25)16-20(26)24-14-12-23(13-15-24)17-4-3-5-17/h6-7,17H,2-5,8-16H2,1H3 |
| InChIKey | RJDQBGUBLPUWIX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |