C14H21BrN2OS — CID 80665316
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-ethylthiophen-2-yl)methanone (PubChem CID 80665316) has the molecular formula C14H21BrN2OS and a molecular weight of 345.31 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-ethylthiophen-2-yl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-ethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 80665316 |
| Molecular Formula | C14H21BrN2OS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-ethylthiophen-2-yl)methanone |
| SMILES | CCc1ccc(C(=O)N2CCCN(CCBr)CC2)s1 |
| InChI | InChI=1S/C14H21BrN2OS/c1-2-12-4-5-13(19-12)14(18)17-8-3-7-16(9-6-15)10-11-17/h4-5H,2-3,6-11H2,1H3 |
| InChIKey | XZDLKHJWKFTBKI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|