C12H16BrClN2O2 — CID 106689935
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-chlorofuran-2-yl)methanone (PubChem CID 106689935) has the molecular formula C12H16BrClN2O2 and a molecular weight of 335.63 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-chlorofuran-2-yl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-chlorofuran-2-yl)methanone |
|---|---|
| PubChem CID | 106689935 |
| Molecular Formula | C12H16BrClN2O2 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(5-chlorofuran-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)o1)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C12H16BrClN2O2/c13-4-7-15-5-1-6-16(9-8-15)12(17)10-2-3-11(14)18-10/h2-3H,1,4-9H2 |
| InChIKey | AKINRSDTKBOTCX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|