C13H17ClN2O3 — CID 87030559
1-[4-(5-chlorofuran-2-carbonyl)-1,4-diazepan-1-yl]propan-1-one (PubChem CID 87030559) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 1-[4-(5-chlorofuran-2-carbonyl)-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(5-chlorofuran-2-carbonyl)-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 87030559 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[4-(5-chlorofuran-2-carbonyl)-1,4-diazepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCCN(C(=O)c2ccc(Cl)o2)CC1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-2-12(17)15-6-3-7-16(9-8-15)13(18)10-4-5-11(14)19-10/h4-5H,2-3,6-9H2,1H3 |
| InChIKey | MWWYVKJEICDNII-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |