C12H16ClN3O2S — CID 106684952
2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]propanethioamide (PubChem CID 106684952) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 106684952 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]propanethioamide |
| SMILES | CC(C(N)=S)N1CCN(C(=O)c2ccc(Cl)o2)CC1 |
| InChI | InChI=1S/C12H16ClN3O2S/c1-8(11(14)19)15-4-6-16(7-5-15)12(17)9-2-3-10(13)18-9/h2-3,8H,4-7H2,1H3,(H2,14,19) |
| InChIKey | RSNQVSVEEPEQPK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|