C12H15Br2N3OS2 — CID 107961801
2-[4-(2,5-dibromothiophene-3-carbonyl)piperazin-1-yl]propanethioamide (PubChem CID 107961801) has the molecular formula C12H15Br2N3OS2 and a molecular weight of 441.21 g/mol. Its IUPAC name is 2-[4-(2,5-dibromothiophene-3-carbonyl)piperazin-1-yl]propanethioamide.
| Compound Name | 2-[4-(2,5-dibromothiophene-3-carbonyl)piperazin-1-yl]propanethioamide |
|---|---|
| PubChem CID | 107961801 |
| Molecular Formula | C12H15Br2N3OS2 |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 438.90 |
| IUPAC Name | 2-[4-(2,5-dibromothiophene-3-carbonyl)piperazin-1-yl]propanethioamide |
| SMILES | CC(C(N)=S)N1CCN(C(=O)c2cc(Br)sc2Br)CC1 |
| InChI | InChI=1S/C12H15Br2N3OS2/c1-7(11(15)19)16-2-4-17(5-3-16)12(18)8-6-9(13)20-10(8)14/h6-7H,2-5H2,1H3,(H2,15,19) |
| InChIKey | KQIAMDCQOKGQJZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|