C11H12Br2N2OS2 — CID 114021251
1-(2,5-dibromothiophene-3-carbonyl)piperidine-4-carbothioamide (PubChem CID 114021251) has the molecular formula C11H12Br2N2OS2 and a molecular weight of 412.17 g/mol. Its IUPAC name is 1-(2,5-dibromothiophene-3-carbonyl)piperidine-4-carbothioamide.
| Compound Name | 1-(2,5-dibromothiophene-3-carbonyl)piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 114021251 |
| Molecular Formula | C11H12Br2N2OS2 |
| Molecular Weight | 412.17 g/mol |
| Exact Mass | 409.88 |
| IUPAC Name | 1-(2,5-dibromothiophene-3-carbonyl)piperidine-4-carbothioamide |
| SMILES | NC(=S)C1CCN(C(=O)c2cc(Br)sc2Br)CC1 |
| InChI | InChI=1S/C11H12Br2N2OS2/c12-8-5-7(9(13)18-8)11(16)15-3-1-6(2-4-15)10(14)17/h5-6H,1-4H2,(H2,14,17) |
| InChIKey | PHLUTLZWZSAYMN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|