C14H18BrClN2O2 — CID 106503101
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(2-chloro-5-hydroxyphenyl)methanone (PubChem CID 106503101) has the molecular formula C14H18BrClN2O2 and a molecular weight of 361.67 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(2-chloro-5-hydroxyphenyl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(2-chloro-5-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 106503101 |
| Molecular Formula | C14H18BrClN2O2 |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(2-chloro-5-hydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)ccc1Cl)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C14H18BrClN2O2/c15-4-7-17-5-1-6-18(9-8-17)14(20)12-10-11(19)2-3-13(12)16/h2-3,10,19H,1,4-9H2 |
| InChIKey | HTASQUPUMUJVHD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|