C14H17BrClNO3 — CID 106503185
[4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-hydroxyphenyl)methanone (PubChem CID 106503185) has the molecular formula C14H17BrClNO3 and a molecular weight of 362.65 g/mol. Its IUPAC name is [4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-hydroxyphenyl)methanone.
| Compound Name | [4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 106503185 |
| Molecular Formula | C14H17BrClNO3 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | [4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-hydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)ccc1Cl)N1CCC(OCCBr)CC1 |
| InChI | InChI=1S/C14H17BrClNO3/c15-5-8-20-11-3-6-17(7-4-11)14(19)12-9-10(18)1-2-13(12)16/h1-2,9,11,18H,3-8H2 |
| InChIKey | RWIOEUDWXHXEIA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|