C15H19BrClNO2S — CID 82687777
[4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone (PubChem CID 82687777) has the molecular formula C15H19BrClNO2S and a molecular weight of 392.75 g/mol. Its IUPAC name is [4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone.
| Compound Name | [4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 82687777 |
| Molecular Formula | C15H19BrClNO2S |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | [4-(2-bromoethoxy)piperidin-1-yl]-(2-chloro-5-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCC(OCCBr)CC2)c1 |
| InChI | InChI=1S/C15H19BrClNO2S/c1-21-12-2-3-14(17)13(10-12)15(19)18-7-4-11(5-8-18)20-9-6-16/h2-3,10-11H,4-9H2,1H3 |
| InChIKey | SNWGOGAZMUDDGH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|