C16H23ClN2OS — CID 112765531
(2-chloro-5-methylsulfanylphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone (PubChem CID 112765531) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is (2-chloro-5-methylsulfanylphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-5-methylsulfanylphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112765531 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2-chloro-5-methylsulfanylphenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCN(CC(C)C)CC2)c1 |
| InChI | InChI=1S/C16H23ClN2OS/c1-12(2)11-18-6-8-19(9-7-18)16(20)14-10-13(21-3)4-5-15(14)17/h4-5,10,12H,6-9,11H2,1-3H3 |
| InChIKey | HROHWRZZDCLVAN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |