C12H14ClNO2S — CID 62916589
(2-chloro-5-methylsulfanylphenyl)-(3-hydroxypyrrolidin-1-yl)methanone (PubChem CID 62916589) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is (2-chloro-5-methylsulfanylphenyl)-(3-hydroxypyrrolidin-1-yl)methanone.
| Compound Name | (2-chloro-5-methylsulfanylphenyl)-(3-hydroxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 62916589 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | (2-chloro-5-methylsulfanylphenyl)-(3-hydroxypyrrolidin-1-yl)methanone |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCC(O)C2)c1 |
| InChI | InChI=1S/C12H14ClNO2S/c1-17-9-2-3-11(13)10(6-9)12(16)14-5-4-8(15)7-14/h2-3,6,8,15H,4-5,7H2,1H3 |
| InChIKey | LZANROYOXRWIOS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |