C14H15ClF3NOS — CID 51922925
(2-chloro-5-methylsulfanylphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 51922925) has the molecular formula C14H15ClF3NOS and a molecular weight of 337.79 g/mol. Its IUPAC name is (2-chloro-5-methylsulfanylphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-methylsulfanylphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 51922925 |
| Molecular Formula | C14H15ClF3NOS |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | (2-chloro-5-methylsulfanylphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | CSc1ccc(Cl)c(C(=O)N2CCC[C@H](C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C14H15ClF3NOS/c1-21-10-4-5-12(15)11(7-10)13(20)19-6-2-3-9(8-19)14(16,17)18/h4-5,7,9H,2-3,6,8H2,1H3/t9-/m0/s1 |
| InChIKey | CKDZPWFURBHNIT-VIFPVBQESA-N |
| XLogP | 4.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |