C13H13ClF3NO2 — CID 31640799
(5-chloro-2-hydroxyphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 31640799) has the molecular formula C13H13ClF3NO2 and a molecular weight of 307.70 g/mol. Its IUPAC name is (5-chloro-2-hydroxyphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (5-chloro-2-hydroxyphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 31640799 |
| Molecular Formula | C13H13ClF3NO2 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (5-chloro-2-hydroxyphenyl)-[(3S)-3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1O)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C13H13ClF3NO2/c14-9-3-4-11(19)10(6-9)12(20)18-5-1-2-8(7-18)13(15,16)17/h3-4,6,8,19H,1-2,5,7H2/t8-/m0/s1 |
| InChIKey | YILOXJPPMCMGJB-QMMMGPOBSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |