C18H22F4N2O — CID 171361971
(2-fluoro-5-piperidin-4-ylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 171361971) has the molecular formula C18H22F4N2O and a molecular weight of 358.38 g/mol. Its IUPAC name is (2-fluoro-5-piperidin-4-ylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | (2-fluoro-5-piperidin-4-ylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 171361971 |
| Molecular Formula | C18H22F4N2O |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2-fluoro-5-piperidin-4-ylphenyl)-[3-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(C2CCNCC2)ccc1F)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H22F4N2O/c19-16-4-3-13(12-5-7-23-8-6-12)10-15(16)17(25)24-9-1-2-14(11-24)18(20,21)22/h3-4,10,12,14,23H,1-2,5-9,11H2 |
| InChIKey | XVROCOMYJNZMCF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |