C20H17F4NO2 — CID 39975265
(4-fluorophenyl)-[2-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]phenyl]methanone (PubChem CID 39975265) has the molecular formula C20H17F4NO2 and a molecular weight of 379.35 g/mol. Its IUPAC name is (4-fluorophenyl)-[2-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]phenyl]methanone.
| Compound Name | (4-fluorophenyl)-[2-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]phenyl]methanone |
|---|---|
| PubChem CID | 39975265 |
| Molecular Formula | C20H17F4NO2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (4-fluorophenyl)-[2-[(3S)-3-(trifluoromethyl)piperidine-1-carbonyl]phenyl]methanone |
| SMILES | O=C(c1ccc(F)cc1)c1ccccc1C(=O)N1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C20H17F4NO2/c21-15-9-7-13(8-10-15)18(26)16-5-1-2-6-17(16)19(27)25-11-3-4-14(12-25)20(22,23)24/h1-2,5-10,14H,3-4,11-12H2/t14-/m0/s1 |
| InChIKey | FAHGYLLJJRUKPT-AWEZNQCLSA-N |
| XLogP | 4.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |