C17H22ClF3N2O2 — CID 166001197
[4-piperidin-4-yl-2-(trifluoromethoxy)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride (PubChem CID 166001197) has the molecular formula C17H22ClF3N2O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is [4-piperidin-4-yl-2-(trifluoromethoxy)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride.
| Compound Name | [4-piperidin-4-yl-2-(trifluoromethoxy)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 166001197 |
| Molecular Formula | C17H22ClF3N2O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [4-piperidin-4-yl-2-(trifluoromethoxy)phenyl]-pyrrolidin-1-ylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(C2CCNCC2)cc1OC(F)(F)F)N1CCCC1 |
| InChI | InChI=1S/C17H21F3N2O2.ClH/c18-17(19,20)24-15-11-13(12-5-7-21-8-6-12)3-4-14(15)16(23)22-9-1-2-10-22;/h3-4,11-12,21H,1-2,5-10H2;1H |
| InChIKey | WVVHZXCZQBUSDP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |