C16H22ClF3N2O3 — CID 171393402
N-(2-methoxyethyl)-5-piperidin-4-yl-2-(trifluoromethoxy)benzamide;hydrochloride (PubChem CID 171393402) has the molecular formula C16H22ClF3N2O3 and a molecular weight of 382.81 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-piperidin-4-yl-2-(trifluoromethoxy)benzamide;hydrochloride.
| Compound Name | N-(2-methoxyethyl)-5-piperidin-4-yl-2-(trifluoromethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 171393402 |
| Molecular Formula | C16H22ClF3N2O3 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-(2-methoxyethyl)-5-piperidin-4-yl-2-(trifluoromethoxy)benzamide;hydrochloride |
| SMILES | COCCNC(=O)c1cc(C2CCNCC2)ccc1OC(F)(F)F.Cl |
| InChI | InChI=1S/C16H21F3N2O3.ClH/c1-23-9-8-21-15(22)13-10-12(11-4-6-20-7-5-11)2-3-14(13)24-16(17,18)19;/h2-3,10-11,20H,4-9H2,1H3,(H,21,22);1H |
| InChIKey | ZVJZNBCTHCSOPF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|