C16H22F3NO2 — CID 170758523
ethane;methyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate (PubChem CID 170758523) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethane;methyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate.
| Compound Name | ethane;methyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 170758523 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | ethane;methyl 4-piperidin-4-yl-2-(trifluoromethyl)benzoate |
| SMILES | CC.COC(=O)c1ccc(C2CCNCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2.C2H6/c1-20-13(19)11-3-2-10(8-12(11)14(15,16)17)9-4-6-18-7-5-9;1-2/h2-3,8-9,18H,4-7H2,1H3;1-2H3 |
| InChIKey | SICVQNFAWBRZBN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |