C10H9F3N2O2S — CID 169356881
methyl 4-(carbamothioylamino)-2-(trifluoromethyl)benzoate (PubChem CID 169356881) has the molecular formula C10H9F3N2O2S and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 4-(carbamothioylamino)-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-(carbamothioylamino)-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 169356881 |
| Molecular Formula | C10H9F3N2O2S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | methyl 4-(carbamothioylamino)-2-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(NC(N)=S)cc1C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O2S/c1-17-8(16)6-3-2-5(15-9(14)18)4-7(6)10(11,12)13/h2-4H,1H3,(H3,14,15,18) |
| InChIKey | HBNVJKMSDKSYTE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|