C8H6ClF3N2S — CID 152709194
[3-chloro-4-(trifluoromethyl)phenyl]thiourea (PubChem CID 152709194) has the molecular formula C8H6ClF3N2S and a molecular weight of 254.66 g/mol. Its IUPAC name is [3-chloro-4-(trifluoromethyl)phenyl]thiourea.
| Compound Name | [3-chloro-4-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 152709194 |
| Molecular Formula | C8H6ClF3N2S |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | [3-chloro-4-(trifluoromethyl)phenyl]thiourea |
| SMILES | NC(=S)Nc1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H6ClF3N2S/c9-6-3-4(14-7(13)15)1-2-5(6)8(10,11)12/h1-3H,(H3,13,14,15) |
| InChIKey | ZTFYTWYVLBCVSY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|