C18H12ClF3N4O2S — CID 3006479
N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 3006479) has the molecular formula C18H12ClF3N4O2S and a molecular weight of 440.83 g/mol. Its IUPAC name is N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3006479 |
| Molecular Formula | C18H12ClF3N4O2S |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | N-[4-[[3-chloro-4-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2ccc(C(F)(F)F)c(Cl)c2)cc1)c1cocn1 |
| InChI | InChI=1S/C18H12ClF3N4O2S/c19-14-7-12(5-6-13(14)18(20,21)22)26-17(29)25-11-3-1-10(2-4-11)24-16(27)15-8-28-9-23-15/h1-9H,(H,24,27)(H2,25,26,29) |
| InChIKey | OSHRDSSOIYWOJG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|