C13H9N3O4 — CID 155164296
5-(1,3-oxazole-4-carbonylamino)isoindole-2-carboxylic acid (PubChem CID 155164296) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 5-(1,3-oxazole-4-carbonylamino)isoindole-2-carboxylic acid.
| Compound Name | 5-(1,3-oxazole-4-carbonylamino)isoindole-2-carboxylic acid |
|---|---|
| PubChem CID | 155164296 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 5-(1,3-oxazole-4-carbonylamino)isoindole-2-carboxylic acid |
| SMILES | O=C(Nc1ccc2cn(C(=O)O)cc2c1)c1cocn1 |
| InChI | InChI=1S/C13H9N3O4/c17-12(11-6-20-7-14-11)15-10-2-1-8-4-16(13(18)19)5-9(8)3-10/h1-7H,(H,15,17)(H,18,19) |
| InChIKey | NRQGCTUXDQAUNE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |