About N-(4-aminophenyl)-1,3-oxazole-4-carboxamide
N-(4-aminophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 22612942) has the molecular formula C10H9N3O2
and a molecular weight of 203.20 g/mol. Its IUPAC name is N-(4-aminophenyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-aminophenyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 22612942 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(4-aminophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2cocn2)cc1 |
| InChI | InChI=1S/C10H9N3O2/c11-7-1-3-8(4-2-7)13-10(14)9-5-15-6-12-9/h1-6H,11H2,(H,13,14) |
| InChIKey | RPKYMIBHHCYBLG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminophenyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminophenyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(4-aminophenyl)-1,3-oxazole-4-carboxamide (CID 22612942) is N-(4-aminophenyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(4-aminophenyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(4-aminophenyl)-1,3-oxazole-4-carboxamide is Nc1ccc(NC(=O)c2cocn2)cc1.
What is the InChIKey of N-(4-aminophenyl)-1,3-oxazole-4-carboxamide?
The InChIKey is RPKYMIBHHCYBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O2/c11-7-1-3-8(4-2-7)13-10(14)9-5-15-6-12-9/h1-6H,11H2,(H,13,14).
What are the key properties of N-(4-aminophenyl)-1,3-oxazole-4-carboxamide?
N-(4-aminophenyl)-1,3-oxazole-4-carboxamide has a molecular weight of 203.20 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminophenyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 22612942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).