C10H9N3O2 — CID 22612942
N-(4-aminophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 22612942) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is N-(4-aminophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-aminophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 22612942 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | N-(4-aminophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2cocn2)cc1 |
| InChI | InChI=1S/C10H9N3O2/c11-7-1-3-8(4-2-7)13-10(14)9-5-15-6-12-9/h1-6H,11H2,(H,13,14) |
| InChIKey | RPKYMIBHHCYBLG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|