C14H16N2O2 — CID 110689557
N-(2,6-diethylphenyl)-1,3-oxazole-4-carboxamide (PubChem CID 110689557) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110689557 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-(2,6-diethylphenyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1cocn1 |
| InChI | InChI=1S/C14H16N2O2/c1-3-10-6-5-7-11(4-2)13(10)16-14(17)12-8-18-9-15-12/h5-9H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | QHMKPQXGGNJFTF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |