C18H13ClF3N5OS2 — CID 57233891
N-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide (PubChem CID 57233891) has the molecular formula C18H13ClF3N5OS2 and a molecular weight of 471.92 g/mol. Its IUPAC name is N-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 57233891 |
| Molecular Formula | C18H13ClF3N5OS2 |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | N-[4-[[[4-chloro-3-(trifluoromethyl)phenyl]carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(CNC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1)c1csnn1 |
| InChI | InChI=1S/C18H13ClF3N5OS2/c19-14-6-5-12(7-13(14)18(20,21)22)25-17(29)23-8-10-1-3-11(4-2-10)24-16(28)15-9-30-27-26-15/h1-7,9H,8H2,(H,24,28)(H2,23,25,29) |
| InChIKey | KUIGHWIFKSQLNT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|