C18H15F2N5OS2 — CID 90830649
N-[4-[[(3,5-difluoro-2-methylphenyl)carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide (PubChem CID 90830649) has the molecular formula C18H15F2N5OS2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[4-[[(3,5-difluoro-2-methylphenyl)carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[[(3,5-difluoro-2-methylphenyl)carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 90830649 |
| Molecular Formula | C18H15F2N5OS2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[4-[[(3,5-difluoro-2-methylphenyl)carbamothioylamino]methyl]phenyl]thiadiazole-4-carboxamide |
| SMILES | Cc1c(F)cc(F)cc1NC(=S)NCc1ccc(NC(=O)c2csnn2)cc1 |
| InChI | InChI=1S/C18H15F2N5OS2/c1-10-14(20)6-12(19)7-15(10)23-18(27)21-8-11-2-4-13(5-3-11)22-17(26)16-9-28-25-24-16/h2-7,9H,8H2,1H3,(H,22,26)(H2,21,23,27) |
| InChIKey | UFANRSIFUOMJON-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|