C19H15F4N5OS2 — CID 158243478
N-[4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide (PubChem CID 158243478) has the molecular formula C19H15F4N5OS2 and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 158243478 |
| Molecular Formula | C19H15F4N5OS2 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-[4-[2-[2-fluoro-4-(trifluoromethyl)phenyl]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)NCCc2ccc(C(F)(F)F)cc2F)cc1)c1csnn1 |
| InChI | InChI=1S/C19H15F4N5OS2/c20-15-9-12(19(21,22)23)2-1-11(15)7-8-24-18(30)26-14-5-3-13(4-6-14)25-17(29)16-10-31-28-27-16/h1-6,9-10H,7-8H2,(H,25,29)(H2,24,26,30) |
| InChIKey | GFVLDNNOUZNBKO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|