C18H17N5O2S2 — CID 10135570
N-[4-(2-phenoxyethylcarbamothioylamino)phenyl]thiadiazole-4-carboxamide (PubChem CID 10135570) has the molecular formula C18H17N5O2S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[4-(2-phenoxyethylcarbamothioylamino)phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-(2-phenoxyethylcarbamothioylamino)phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 10135570 |
| Molecular Formula | C18H17N5O2S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[4-(2-phenoxyethylcarbamothioylamino)phenyl]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)NCCOc2ccccc2)cc1)c1csnn1 |
| InChI | InChI=1S/C18H17N5O2S2/c24-17(16-12-27-23-22-16)20-13-6-8-14(9-7-13)21-18(26)19-10-11-25-15-4-2-1-3-5-15/h1-9,12H,10-11H2,(H,20,24)(H2,19,21,26) |
| InChIKey | XRVBTERVFZMWII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|