C19H15F4N5O2S2 — CID 10184621
N-[4-[2-[2-fluoro-5-(trifluoromethyl)phenoxy]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide (PubChem CID 10184621) has the molecular formula C19H15F4N5O2S2 and a molecular weight of 485.49 g/mol. Its IUPAC name is N-[4-[2-[2-fluoro-5-(trifluoromethyl)phenoxy]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[2-[2-fluoro-5-(trifluoromethyl)phenoxy]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 10184621 |
| Molecular Formula | C19H15F4N5O2S2 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[4-[2-[2-fluoro-5-(trifluoromethyl)phenoxy]ethylcarbamothioylamino]phenyl]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)NCCOc2cc(C(F)(F)F)ccc2F)cc1)c1csnn1 |
| InChI | InChI=1S/C19H15F4N5O2S2/c20-14-6-1-11(19(21,22)23)9-16(14)30-8-7-24-18(31)26-13-4-2-12(3-5-13)25-17(29)15-10-32-28-27-15/h1-6,9-10H,7-8H2,(H,25,29)(H2,24,26,31) |
| InChIKey | QNJWBYBWGNYHGV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|