C21H20F3N5OS2 — CID 10184251
N-[4-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide (PubChem CID 10184251) has the molecular formula C21H20F3N5OS2 and a molecular weight of 479.55 g/mol. Its IUPAC name is N-[4-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 10184251 |
| Molecular Formula | C21H20F3N5OS2 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | N-[4-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]thiadiazole-4-carboxamide |
| SMILES | CC(C)Cc1ccc(NC(=S)Nc2ccc(NC(=O)c3csnn3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H20F3N5OS2/c1-12(2)9-13-3-4-16(10-17(13)21(22,23)24)27-20(31)26-15-7-5-14(6-8-15)25-19(30)18-11-32-29-28-18/h3-8,10-12H,9H2,1-2H3,(H,25,30)(H2,26,27,31) |
| InChIKey | ILGMAYKFKCUVFY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|