C16H11Cl2N5OS2 — CID 57052154
N-[4-[(2,3-dichlorophenyl)carbamothioylamino]phenyl]thiadiazole-4-carboxamide (PubChem CID 57052154) has the molecular formula C16H11Cl2N5OS2 and a molecular weight of 424.34 g/mol. Its IUPAC name is N-[4-[(2,3-dichlorophenyl)carbamothioylamino]phenyl]thiadiazole-4-carboxamide.
| Compound Name | N-[4-[(2,3-dichlorophenyl)carbamothioylamino]phenyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 57052154 |
| Molecular Formula | C16H11Cl2N5OS2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | N-[4-[(2,3-dichlorophenyl)carbamothioylamino]phenyl]thiadiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2cccc(Cl)c2Cl)cc1)c1csnn1 |
| InChI | InChI=1S/C16H11Cl2N5OS2/c17-11-2-1-3-12(14(11)18)21-16(25)20-10-6-4-9(5-7-10)19-15(24)13-8-26-23-22-13/h1-8H,(H,19,24)(H2,20,21,25) |
| InChIKey | RVDABKQPBVJEJP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|