C19H22Cl3N3S — CID 2956827
1-(2,3-dichlorophenyl)-3-[4-(piperidin-1-ylmethyl)phenyl]thiourea;hydrochloride (PubChem CID 2956827) has the molecular formula C19H22Cl3N3S and a molecular weight of 430.83 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[4-(piperidin-1-ylmethyl)phenyl]thiourea;hydrochloride.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[4-(piperidin-1-ylmethyl)phenyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 2956827 |
| Molecular Formula | C19H22Cl3N3S |
| Molecular Weight | 430.83 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[4-(piperidin-1-ylmethyl)phenyl]thiourea;hydrochloride |
| SMILES | Cl.S=C(Nc1ccc(CN2CCCCC2)cc1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H21Cl2N3S.ClH/c20-16-5-4-6-17(18(16)21)23-19(25)22-15-9-7-14(8-10-15)13-24-11-2-1-3-12-24;/h4-10H,1-3,11-13H2,(H2,22,23,25);1H |
| InChIKey | SBDQNHVGFKVXST-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.83 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|