C24H25N3OS — CID 3316137
N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 3316137) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3316137 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[[4-(piperidin-1-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(CN2CCCCC2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H25N3OS/c28-23(22-10-6-8-19-7-2-3-9-21(19)22)26-24(29)25-20-13-11-18(12-14-20)17-27-15-4-1-5-16-27/h2-3,6-14H,1,4-5,15-17H2,(H2,25,26,28,29) |
| InChIKey | NCUNJLGXNMXCME-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|