C23H23N3O2S — CID 979219
N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 979219) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 979219 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-[[4-(morpholin-4-ylmethyl)phenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(CN2CCOCC2)cc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H23N3O2S/c27-22(21-7-3-5-18-4-1-2-6-20(18)21)25-23(29)24-19-10-8-17(9-11-19)16-26-12-14-28-15-13-26/h1-11H,12-16H2,(H2,24,25,27,29) |
| InChIKey | HWKCPKJRSZIINX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|