C11H11N3OS — CID 1454928
N-(4-ethylphenyl)thiadiazole-4-carboxamide (PubChem CID 1454928) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is N-(4-ethylphenyl)thiadiazole-4-carboxamide.
| Compound Name | N-(4-ethylphenyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 1454928 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | N-(4-ethylphenyl)thiadiazole-4-carboxamide |
| SMILES | CCc1ccc(NC(=O)c2csnn2)cc1 |
| InChI | InChI=1S/C11H11N3OS/c1-2-8-3-5-9(6-4-8)12-11(15)10-7-16-14-13-10/h3-7H,2H2,1H3,(H,12,15) |
| InChIKey | IORANNDCOYLTKE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |