C11H9Cl2N3O3S3 — CID 59654557
1-(2,3-dichlorophenyl)-3-(4-hydroxy-5-sulfamoylthiophen-3-yl)thiourea (PubChem CID 59654557) has the molecular formula C11H9Cl2N3O3S3 and a molecular weight of 398.32 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-(4-hydroxy-5-sulfamoylthiophen-3-yl)thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-(4-hydroxy-5-sulfamoylthiophen-3-yl)thiourea |
|---|---|
| PubChem CID | 59654557 |
| Molecular Formula | C11H9Cl2N3O3S3 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-(4-hydroxy-5-sulfamoylthiophen-3-yl)thiourea |
| SMILES | NS(=O)(=O)c1scc(NC(=S)Nc2cccc(Cl)c2Cl)c1O |
| InChI | InChI=1S/C11H9Cl2N3O3S3/c12-5-2-1-3-6(8(5)13)15-11(20)16-7-4-21-10(9(7)17)22(14,18)19/h1-4,17H,(H2,14,18,19)(H2,15,16,20) |
| InChIKey | CVXRPOMQUZORSH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|