C16H11Cl2N3OS2 — CID 2205585
1-(1-benzothiophene-3-carbonylamino)-3-(2,3-dichlorophenyl)thiourea (PubChem CID 2205585) has the molecular formula C16H11Cl2N3OS2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 1-(1-benzothiophene-3-carbonylamino)-3-(2,3-dichlorophenyl)thiourea.
| Compound Name | 1-(1-benzothiophene-3-carbonylamino)-3-(2,3-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 2205585 |
| Molecular Formula | C16H11Cl2N3OS2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | 1-(1-benzothiophene-3-carbonylamino)-3-(2,3-dichlorophenyl)thiourea |
| SMILES | O=C(NNC(=S)Nc1cccc(Cl)c1Cl)c1csc2ccccc12 |
| InChI | InChI=1S/C16H11Cl2N3OS2/c17-11-5-3-6-12(14(11)18)19-16(23)21-20-15(22)10-8-24-13-7-2-1-4-9(10)13/h1-8H,(H,20,22)(H2,19,21,23) |
| InChIKey | GPXZOARCAAOWAT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|