C14H15Cl2N3O3S3 — CID 11583010
1-(2,3-dichlorophenyl)-3-[5-[ethyl(methyl)sulfamoyl]-4-oxothiophen-3-yl]thiourea (PubChem CID 11583010) has the molecular formula C14H15Cl2N3O3S3 and a molecular weight of 440.40 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[5-[ethyl(methyl)sulfamoyl]-4-oxothiophen-3-yl]thiourea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[5-[ethyl(methyl)sulfamoyl]-4-oxothiophen-3-yl]thiourea |
|---|---|
| PubChem CID | 11583010 |
| Molecular Formula | C14H15Cl2N3O3S3 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 438.97 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[5-[ethyl(methyl)sulfamoyl]-4-oxothiophen-3-yl]thiourea |
| SMILES | CCN(C)S(=O)(=O)C1SC=C(NC(=S)Nc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C14H15Cl2N3O3S3/c1-3-19(2)25(21,22)13-12(20)10(7-24-13)18-14(23)17-9-6-4-5-8(15)11(9)16/h4-7,13H,3H2,1-2H3,(H2,17,18,23) |
| InChIKey | IJJUUULCAHJCBB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|