C16H17Cl2N3O5S2 — CID 59654480
1-(2,3-dichlorophenyl)-3-[4-hydroxy-5-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylthiophen-3-yl]urea (PubChem CID 59654480) has the molecular formula C16H17Cl2N3O5S2 and a molecular weight of 466.37 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[4-hydroxy-5-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylthiophen-3-yl]urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[4-hydroxy-5-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylthiophen-3-yl]urea |
|---|---|
| PubChem CID | 59654480 |
| Molecular Formula | C16H17Cl2N3O5S2 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[4-hydroxy-5-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylthiophen-3-yl]urea |
| SMILES | O=C(Nc1csc(S(=O)(=O)N2CCC[C@@H]2CO)c1O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H17Cl2N3O5S2/c17-10-4-1-5-11(13(10)18)19-16(24)20-12-8-27-15(14(12)23)28(25,26)21-6-2-3-9(21)7-22/h1,4-5,8-9,22-23H,2-3,6-7H2,(H2,19,20,24)/t9-/m1/s1 |
| InChIKey | JSKUSZZMQFAZQR-SECBINFHSA-N |
| XLogP | 3.55 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|