C18H18Cl3N3O4S — CID 18373567
1-[4-chloro-3-(cyclopentylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 18373567) has the molecular formula C18H18Cl3N3O4S and a molecular weight of 478.79 g/mol. Its IUPAC name is 1-[4-chloro-3-(cyclopentylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea.
| Compound Name | 1-[4-chloro-3-(cyclopentylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea |
|---|---|
| PubChem CID | 18373567 |
| Molecular Formula | C18H18Cl3N3O4S |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 1-[4-chloro-3-(cyclopentylsulfamoyl)-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)NC2CCCC2)c1O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H18Cl3N3O4S/c19-11-6-3-7-13(15(11)21)22-18(26)23-14-9-8-12(20)17(16(14)25)29(27,28)24-10-4-1-2-5-10/h3,6-10,24-25H,1-2,4-5H2,(H2,22,23,26) |
| InChIKey | HPEOFHIRFSXHEE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|