C18H18Cl3F3N4O6S — CID 11613999
1-[3-(3-aminopropylsulfamoyl)-4-chloro-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea;2,2,2-trifluoroacetic acid (PubChem CID 11613999) has the molecular formula C18H18Cl3F3N4O6S and a molecular weight of 581.78 g/mol. Its IUPAC name is 1-[3-(3-aminopropylsulfamoyl)-4-chloro-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[3-(3-aminopropylsulfamoyl)-4-chloro-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11613999 |
| Molecular Formula | C18H18Cl3F3N4O6S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 580.00 |
| IUPAC Name | 1-[3-(3-aminopropylsulfamoyl)-4-chloro-2-hydroxyphenyl]-3-(2,3-dichlorophenyl)urea;2,2,2-trifluoroacetic acid |
| SMILES | NCCCNS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2cccc(Cl)c2Cl)c1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H17Cl3N4O4S.C2HF3O2/c17-9-3-1-4-11(13(9)19)22-16(25)23-12-6-5-10(18)15(14(12)24)28(26,27)21-8-2-7-20;3-2(4,5)1(6)7/h1,3-6,21,24H,2,7-8,20H2,(H2,22,23,25);(H,6,7) |
| InChIKey | ZKTJMPNHMFVMRB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|