C12H14F6N2O6S2 — CID 167864746
N-(3-aminopropyl)-2-(trifluoromethylsulfonyl)benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 167864746) has the molecular formula C12H14F6N2O6S2 and a molecular weight of 460.37 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-(trifluoromethylsulfonyl)benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(3-aminopropyl)-2-(trifluoromethylsulfonyl)benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167864746 |
| Molecular Formula | C12H14F6N2O6S2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | N-(3-aminopropyl)-2-(trifluoromethylsulfonyl)benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCNS(=O)(=O)c1ccccc1S(=O)(=O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O4S2.C2HF3O2/c11-10(12,13)20(16,17)8-4-1-2-5-9(8)21(18,19)15-7-3-6-14;3-2(4,5)1(6)7/h1-2,4-5,15H,3,6-7,14H2;(H,6,7) |
| InChIKey | UYMBZOVXFBFFGV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|