C16H23ClN2O2S — CID 50987005
N-(6-aminohexyl)naphthalene-1-sulfonamide;hydron;chloride (PubChem CID 50987005) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is N-(6-aminohexyl)naphthalene-1-sulfonamide;hydron;chloride.
| Compound Name | N-(6-aminohexyl)naphthalene-1-sulfonamide;hydron;chloride |
|---|---|
| PubChem CID | 50987005 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-(6-aminohexyl)naphthalene-1-sulfonamide;hydron;chloride |
| SMILES | NCCCCCCNS(=O)(=O)c1cccc2ccccc12.[Cl-].[H+] |
| InChI | InChI=1S/C16H22N2O2S.ClH/c17-12-5-1-2-6-13-18-21(19,20)16-11-7-9-14-8-3-4-10-15(14)16;/h3-4,7-11,18H,1-2,5-6,12-13,17H2;1H |
| InChIKey | HOCSVIGHWPLMFC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|