C25H35N3O2S — CID 58260289
N-[3-(8-aminooctylamino)propyl]anthracene-1-sulfonamide (PubChem CID 58260289) has the molecular formula C25H35N3O2S and a molecular weight of 441.64 g/mol. Its IUPAC name is N-[3-(8-aminooctylamino)propyl]anthracene-1-sulfonamide.
| Compound Name | N-[3-(8-aminooctylamino)propyl]anthracene-1-sulfonamide |
|---|---|
| PubChem CID | 58260289 |
| Molecular Formula | C25H35N3O2S |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | N-[3-(8-aminooctylamino)propyl]anthracene-1-sulfonamide |
| SMILES | NCCCCCCCCNCCCNS(=O)(=O)c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C25H35N3O2S/c26-15-7-3-1-2-4-8-16-27-17-10-18-28-31(29,30)25-14-9-13-23-19-21-11-5-6-12-22(21)20-24(23)25/h5-6,9,11-14,19-20,27-28H,1-4,7-8,10,15-18,26H2 |
| InChIKey | QOWOYPROJMEENZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|